CAS 88068-35-3

3-Tridecanone, 5-methylene-1-phenyl-

Description:

3-Tridecanone, 5-methylene-1-phenyl- is an organic compound characterized by its ketone functional group and a long carbon chain. It features a tridecanone backbone, indicating it has a total of 13 carbon atoms, with a phenyl group attached to the 5-position of the carbon chain. This compound is likely to exhibit properties typical of ketones, such as being a polar solvent and having a relatively high boiling point compared to alkanes of similar molecular weight due to the presence of the carbonyl group. The phenyl group contributes to its aromatic characteristics, potentially influencing its reactivity and solubility in organic solvents. Additionally, the presence of a methylene bridge in the structure may affect its steric and electronic properties. While specific applications or uses may vary, compounds of this nature are often explored in fields such as fragrance chemistry, pharmaceuticals, and materials science due to their unique structural features. As with many organic compounds, safety and handling precautions should be observed, given the potential for reactivity and toxicity.

Formula: C₂₀H₃₀O

InChI: InChI=1S/C20H30O/c1-3-4-5-6-7-9-12-18(2)17-20(21)16-15-19-13-10-8-11-14-19/h8,10-11,13-14H,2-7,9,12,15-17H2,1H3

InChI key: PFZBVIZFZWCMBB-UHFFFAOYSA-N

SMILES: CCCCCCCCC(=C)CC(=O)CCC1=CC=CC=C1