CAS 88069-70-9

1H-Pyrrolizine-7a(5H)-acetamide, N-(3,4-dimethylphenyl)tetrahydro-

Description:

1H-Pyrrolizine-7a(5H)-acetamide, N-(3,4-dimethylphenyl)tetrahydro- is a chemical compound characterized by its unique structure, which includes a pyrrolizine ring fused with a tetrahydro group and an acetamide functional group. This compound features a substitution on the nitrogen atom with a 3,4-dimethylphenyl group, which contributes to its overall hydrophobic character and potential biological activity. The presence of the acetamide moiety suggests that it may exhibit properties typical of amides, such as hydrogen bonding capabilities, which can influence its solubility and reactivity. The compound's molecular structure indicates potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both aromatic and aliphatic components that can interact with biological targets. Additionally, the specific arrangement of substituents may affect its pharmacokinetic properties, including absorption, distribution, metabolism, and excretion. Overall, this compound represents a class of organic molecules that may have significant implications in drug design and development.

Formula: C₁₇H₂₄N₂O

InChI: InChI=1S/C17H24N2O/c1-13-5-6-15(11-14(13)2)18-16(20)12-17-7-3-9-19(17)10-4-8-17/h5-6,11H,3-4,7-10,12H2,1-2H3,(H,18,20)

InChI key: ZGAYDZCPGOIRNX-UHFFFAOYSA-N

SMILES: CC1=C(C=C(C=C1)NC(=O)CC23CCCN2CCC3)C