CAS 88070-44-4
:5-Pyrimidinol, 1-oxide
Description:
5-Pyrimidinol, 1-oxide, also known as 5-hydroxypyrimidine N-oxide, is a heterocyclic organic compound characterized by a pyrimidine ring with a hydroxyl group and an N-oxide functional group. Its molecular structure features a six-membered ring containing nitrogen atoms, which contributes to its basicity and potential reactivity. This compound is typically a white to off-white solid and is soluble in polar solvents due to the presence of the hydroxyl group. 5-Pyrimidinol, 1-oxide is of interest in various fields, including medicinal chemistry and biochemistry, as it may exhibit biological activity and serve as a precursor for the synthesis of other compounds. Its reactivity can be influenced by the N-oxide group, which can participate in oxidation-reduction reactions. Additionally, the compound's stability and properties can vary depending on environmental conditions such as pH and temperature. Overall, 5-Pyrimidinol, 1-oxide is a versatile compound with potential applications in research and industry.
Formula:C4H4N2O2
InChI:InChI=1S/C4H4N2O2/c7-4-1-5-3-6(8)2-4/h1-3,7H
InChI key:InChIKey=UQGFEGTXGVKLNU-UHFFFAOYSA-N
SMILES:OC=1C=N(=O)C=NC1
Synonyms:- 5-Hydroxypyrimidine 1-oxide
- 5-Hydroxypyrimidine1-oxide
- 5-Pyrimidinol, 1-oxide (9CI)
- 5-Pyrimidinol, 1-oxide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
