CAS 88071-33-4

4-Hexenoic acid, 2-fluoro-2-(trifluoromethyl)-, 1-methyl-2-propenyl ester

Description:

4-Hexenoic acid, 2-fluoro-2-(trifluoromethyl)-, 1-methyl-2-propenyl ester, identified by CAS number 88071-33-4, is an organic compound characterized by its unique structure that includes a hexenoic acid backbone with a trifluoromethyl group and a fluoro substituent. This compound typically exhibits properties associated with both unsaturated fatty acids and fluorinated compounds, such as increased stability and altered reactivity due to the presence of fluorine atoms. The unsaturation in the hexenoic acid portion allows for potential polymerization or reaction with other compounds, making it useful in various chemical applications, including as an intermediate in organic synthesis. Additionally, the presence of fluorine can enhance lipophilicity and influence the compound's behavior in biological systems. Overall, this compound's distinctive characteristics make it of interest in fields such as materials science, pharmaceuticals, and agrochemicals, where fluorinated compounds often exhibit unique properties that can be advantageous in specific applications.

Formula: C₁₁H₁₄F₄O₂

InChI: InChI=1S/C11H14F4O2/c1-4-6-7-10(12,11(13,14)15)9(16)17-8(3)5-2/h4-6,8H,2,7H2,1,3H3

InChI key: PTPXATHLWKMGLW-UHFFFAOYSA-N

SMILES: CC=CCC(C(=O)OC(C)C=C)(C(F)(F)F)F