CAS 88072-17-7

Benzoic acid, 4-ethyl-3-(2-oxo-1-azetidinyl)-, methyl ester

Description:

Benzoic acid, 4-ethyl-3-(2-oxo-1-azetidinyl)-, methyl ester, identified by the CAS number 88072-17-7, is an organic compound that features a benzoic acid core modified with an ethyl group and a methyl ester functional group. This compound contains a 2-oxo-1-azetidinyl moiety, which contributes to its unique structural and chemical properties. Typically, compounds of this nature exhibit moderate solubility in organic solvents and may have limited solubility in water due to the hydrophobic nature of the aromatic ring and the ethyl group. The presence of the azetidine ring suggests potential biological activity, as many azetidine derivatives are explored for their pharmacological properties. The methyl ester functional group can influence the compound's reactivity and stability, making it a candidate for various chemical reactions, including esterification and hydrolysis. Overall, this compound's characteristics make it of interest in both synthetic organic chemistry and potential applications in pharmaceuticals or agrochemicals.

Formula: C₁₃H₁₅NO₃

InChI: InChI=1S/C13H15NO3/c1-3-9-4-5-10(13(16)17-2)8-11(9)14-7-6-12(14)15/h4-5,8H,3,6-7H2,1-2H3

InChI key: UYMWRVBZKYTHDZ-UHFFFAOYSA-N

SMILES: CCC1=C(C=C(C=C1)C(=O)OC)N2CCC2=O