CAS 88073-41-0

Spiro[9H-fluorene-9,2'-thiirane], 3',3'-bis(4-methylphenyl)-

Description:

Spiro[9H-fluorene-9,2'-thiirane], 3',3'-bis(4-methylphenyl)-, identified by its CAS number 88073-41-0, is an organic compound characterized by its unique spirocyclic structure, which incorporates a thiirane (sulfur-containing) ring fused with a fluorene moiety. This compound exhibits a complex arrangement of carbon atoms, contributing to its distinctive three-dimensional shape. The presence of the 4-methylphenyl groups enhances its aromatic character and may influence its electronic properties, making it potentially useful in various applications, including organic electronics and materials science. The thiirane ring introduces strain and reactivity, which can be exploited in synthetic chemistry. Additionally, the compound's solubility, stability, and reactivity can be affected by the substituents on the aromatic rings. Overall, this compound represents an interesting class of spiro compounds with potential applications in advanced materials and organic synthesis. However, specific physical and chemical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.

Formula: C₂₈H₂₂S

InChI: InChI=1S/C28H22S/c1-19-11-15-21(16-12-19)27(22-17-13-20(2)14-18-22)28(29-27)25-9-5-3-7-23(25)24-8-4-6-10-26(24)28/h3-18H,1-2H3

InChI key: BJORBISOJGPCLG-UHFFFAOYSA-N

SMILES: CC1=CC=C(C=C1)C2(C3(S2)C4=CC=CC=C4C5=CC=CC=C35)C6=CC=C(C=C6)C