CAS 88074-39-9

Acetamide, N-[(propylamino)carbonyl]-N-[[(propylamino)carbonyl]oxy]-

Description:

Acetamide, N-[(propylamino)carbonyl]-N-[[(propylamino)carbonyl]oxy]- is a chemical compound characterized by its amide functional groups and propylamine substituents. It features a central acetamide structure, where the amide nitrogen is bonded to two propylamino groups, each of which is further connected to a carbonyl group. This compound is likely to exhibit properties typical of amides, such as moderate solubility in polar solvents and the ability to participate in hydrogen bonding due to the presence of the amide functional group. The presence of multiple propylamino groups may influence its reactivity and interactions with other molecules, potentially enhancing its biological activity or altering its physical properties. Additionally, the compound may be of interest in pharmaceutical or biochemical applications, given the structural motifs that are often associated with drug-like properties. However, specific data regarding its melting point, boiling point, and other physical properties would require empirical measurement or detailed literature references.

Formula: C₁₀H₁₉N₃O₄

InChI: InChI=1S/C10H19N3O4/c1-4-6-11-9(15)13(8(3)14)17-10(16)12-7-5-2/h4-7H2,1-3H3,(H,11,15)(H,12,16)

InChI key: SDVNEYFNWCZEDS-UHFFFAOYSA-N

SMILES: CCCNC(=O)N(C(=O)C)OC(=O)NCCC