CAS 88075-50-7
:2-amino-1-methyl-5,6-dihydropyrimidin-4(1H)-one
Description:
2-Amino-1-methyl-5,6-dihydropyrimidin-4(1H)-one, with the CAS number 88075-50-7, is a heterocyclic organic compound characterized by its pyrimidine ring structure, which includes both amino and carbonyl functional groups. This compound typically exhibits a white to off-white crystalline appearance and is soluble in polar solvents such as water and alcohols, owing to the presence of the amino group that can engage in hydrogen bonding. The molecular structure features a methyl group at the first position and an amino group at the second position of the pyrimidine ring, contributing to its basicity and potential reactivity. It is often studied for its biological activity, particularly in medicinal chemistry, where it may serve as a precursor or intermediate in the synthesis of pharmaceuticals. The compound's stability, reactivity, and solubility can vary based on environmental conditions such as pH and temperature, making it a subject of interest in both synthetic and applied chemistry.
Formula:C5H9N3O
InChI:InChI=1/C5H9N3O/c1-8-3-2-4(9)7-5(8)6/h2-3H2,1H3,(H2,6,7,9)
Synonyms:- 4(1H)-Pyrimidinone, 2-amino-5,6-dihydro-1-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
