CAS 88075-93-8
:2-(3-Formyl-1H-pyrrol-1-yl)-4-methylbenzonitrile
Description:
2-(3-Formyl-1H-pyrrol-1-yl)-4-methylbenzonitrile, with the CAS number 88075-93-8, is an organic compound characterized by its complex structure that includes a pyrrole ring and a benzonitrile moiety. This compound features a formyl group (-CHO) attached to the pyrrole, which contributes to its reactivity and potential applications in organic synthesis. The presence of the methyl group on the benzonitrile enhances its hydrophobic characteristics, influencing its solubility in various organic solvents. The nitrile functional group (-C≡N) is known for its ability to participate in nucleophilic reactions, making this compound a valuable intermediate in the synthesis of pharmaceuticals and agrochemicals. Additionally, the compound may exhibit interesting optical and electronic properties due to the conjugated system formed by the pyrrole and benzonitrile units. Overall, 2-(3-Formyl-1H-pyrrol-1-yl)-4-methylbenzonitrile is a versatile compound with potential applications in materials science and medicinal chemistry.
Formula:C13H10N2O
InChI:InChI=1S/C13H10N2O/c1-10-2-3-12(7-14)13(6-10)15-5-4-11(8-15)9-16/h2-6,8-9H,1H3
InChI key:InChIKey=FSCDHZLOIZRECD-UHFFFAOYSA-N
SMILES:C(#N)C1=C(C=C(C)C=C1)N2C=C(C=O)C=C2
Synonyms:- Benzonitrile, 2-(3-formyl-1H-pyrrol-1-yl)-4-methyl-
- 2-(3-Formyl-1H-pyrrol-1-yl)-4-methylbenzonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
