CymitQuimica logo

CAS 88075-98-3

:

8,10-Dodecadien-1-aminium, N,N,N-tributyl-, (E,E)-, methanesulfonate

Description:
8,10-Dodecadien-1-aminium, N,N,N-tributyl-, (E,E)-, methanesulfonate is a quaternary ammonium compound characterized by its long hydrocarbon chain and multiple double bonds. This compound features a dodecadiene backbone, which contributes to its hydrophobic properties, while the tributylammonium group enhances its solubility in organic solvents. The methanesulfonate counterion provides ionic characteristics, making the compound soluble in polar solvents. Its structure suggests potential applications in various fields, including surfactants, emulsifiers, and possibly in drug delivery systems due to its amphiphilic nature. The (E,E) configuration indicates the specific geometric arrangement of the double bonds, which can influence the compound's reactivity and interaction with biological membranes. Additionally, the presence of the quaternary ammonium group may impart antimicrobial properties, making it of interest in biocidal applications. Overall, this compound's unique structural features contribute to its potential utility in both industrial and pharmaceutical contexts.
Formula:C24H48NCH3O3S
InChI:InChI=1S/C24H48N.CH4O3S/c1-5-9-13-14-15-16-17-18-19-20-24-25(21-10-6-2,22-11-7-3)23-12-8-4;1-5(2,3)4/h5,9,13-14H,6-8,10-12,15-24H2,1-4H3;1H3,(H,2,3,4)/q+1;/p-1/b9-5+,14-13+;
InChI key:InChIKey=OPPLZEJXTNMIKB-ZZANMVFPSA-M
SMILES:[N+](CCCCCCC/C=C/C=C/C)(CCCC)(CCCC)CCCC.S(C)(=O)(=O)[O-]
Synonyms:
  • 8,10-Dodecadien-1-aminium, N,N,N-tributyl-, (E,E)-, methanesulfonate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.