CAS 88076-28-2
:2,3-dinitro-1-phenylnaphthalene
Description:
2,3-Dinitro-1-phenylnaphthalene is an organic compound characterized by its complex structure, which includes a naphthalene backbone substituted with a phenyl group and two nitro groups at the 2 and 3 positions. This compound typically appears as a yellow crystalline solid and is known for its relatively high melting point. It is sparingly soluble in water but more soluble in organic solvents such as ethanol and acetone. The presence of nitro groups contributes to its reactivity, making it a potential candidate for various chemical reactions, including nitration and reduction processes. Additionally, 2,3-dinitro-1-phenylnaphthalene may exhibit significant biological activity, which has implications in fields such as pharmacology and toxicology. Safety precautions should be taken when handling this compound, as nitro compounds can be hazardous and may pose environmental risks. Overall, its unique structure and properties make it a subject of interest in both synthetic and applied chemistry.
Formula:C16H10N2O4
InChI:InChI=1/C16H10N2O4/c19-17(20)14-10-12-8-4-5-9-13(12)15(16(14)18(21)22)11-6-2-1-3-7-11/h1-10H
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
