CymitQuimica logo

CAS 880769-49-3

:

1-(Dimethylsilyl)-4-[dimethyl[3-(trichlorosilyl)propyl]silyl]benzene

Description:
1-(Dimethylsilyl)-4-[dimethyl[3-(trichlorosilyl)propyl]silyl]benzene, identified by CAS number 880769-49-3, is a silane compound characterized by its complex structure that includes both dimethylsilyl and trichlorosilyl functional groups attached to a benzene ring. This compound typically exhibits properties associated with organosilicon compounds, such as hydrophobicity and thermal stability. The presence of multiple silicon atoms in its structure suggests potential applications in materials science, particularly in the development of silicone-based polymers or coatings. Additionally, the trichlorosilyl group may impart reactivity, allowing for further chemical modifications or cross-linking in polymer synthesis. The compound's unique silane functionalities can enhance adhesion properties and improve the performance of composite materials. However, due to the presence of chlorine, it may also pose environmental and health considerations, necessitating careful handling and disposal. Overall, this compound represents a versatile building block in organosilicon chemistry with potential applications in various industrial sectors.
Formula:C13H23Cl3Si3
InChI:InChI=1S/C13H23Cl3Si3/c1-17(2)12-6-8-13(9-7-12)18(3,4)10-5-11-19(14,15)16/h6-9,17H,5,10-11H2,1-4H3
InChI key:InChIKey=QUQFVIJLHPRTAM-UHFFFAOYSA-N
SMILES:[Si](CCC[Si](Cl)(Cl)Cl)(C)(C)C1=CC=C([SiH](C)C)C=C1
Synonyms:
  • 1-(Dimethylsilyl)-4-[dimethyl[3-(trichlorosilyl)propyl]silyl]benzene
  • Silane, [4-(dimethylsilyl)phenyl]dimethyl[3-(trichlorosilyl)propyl]-
  • Benzene, 1-(dimethylsilyl)-4-[dimethyl[3-(trichlorosilyl)propyl]silyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.