CymitQuimica logo

CAS 880809-54-1

:

1-(2-methylphenyl)-N-(pyridin-4-ylmethyl)methanamine

Description:
1-(2-methylphenyl)-N-(pyridin-4-ylmethyl)methanamine, with the CAS number 880809-54-1, is an organic compound characterized by its complex structure, which includes a methanamine core substituted with a 2-methylphenyl group and a pyridin-4-ylmethyl group. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in various solvents. The presence of the aromatic rings contributes to its potential for π-π stacking interactions, which may affect its stability and reactivity. Additionally, the pyridine moiety may impart specific electronic properties, making it suitable for various applications in medicinal chemistry and material science. The compound's unique structure suggests potential biological activity, which could be explored in drug development or as a ligand in coordination chemistry. However, detailed studies would be necessary to fully understand its physical and chemical properties, including melting point, boiling point, and reactivity with other substances.
Formula:C14H16N2
InChI:InChI=1/C14H16N2/c1-12-4-2-3-5-14(12)11-16-10-13-6-8-15-9-7-13/h2-9,16H,10-11H2,1H3
SMILES:Cc1ccccc1CNCc1ccncc1
Synonyms:
  • 4-pyridinemethanamine, N-[(2-methylphenyl)methyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.