CymitQuimica logo

CAS 880813-53-6

:

N-(furan-2-ylmethyl)-2-morpholin-4-ylethanamine

Description:
N-(furan-2-ylmethyl)-2-morpholin-4-ylethanamine, with the CAS number 880813-53-6, is a chemical compound characterized by its unique structural features, which include a furan ring and a morpholine moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems due to the presence of the furan and morpholine groups. It is likely to be a polar molecule, which may influence its solubility in various solvents, particularly in polar solvents. The morpholine ring contributes to its potential as a pharmacophore, suggesting possible biological activity, particularly in medicinal chemistry contexts. The presence of the amine functional group indicates that it may engage in hydrogen bonding, affecting its reactivity and interactions with other molecules. Overall, this compound's characteristics make it of interest in research areas such as drug development and organic synthesis, where its unique structure could lead to novel applications or therapeutic agents.
Formula:C11H18N2O2
InChI:InChI=1/C11H18N2O2/c1-2-11(15-7-1)10-12-3-4-13-5-8-14-9-6-13/h1-2,7,12H,3-6,8-10H2
SMILES:c1cc(CNCCN2CCOCC2)oc1
Synonyms:
  • 4-morpholineethanamine, N-(2-furanylmethyl)-
  • N-(2-Furylmethyl)-2-(morpholin-4-yl)ethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.