CAS 88082-60-4
:Cinnamtannin B1
Description:
Cinnamtannin B1 is a polyphenolic compound classified as a type of tannin, primarily derived from the bark of certain plants, particularly those in the Cinnamomum genus. It is known for its complex structure, which includes multiple phenolic units linked by carbon-carbon bonds. This compound exhibits a range of biological activities, including antioxidant, anti-inflammatory, and antimicrobial properties, making it of interest in both food science and pharmacology. Cinnamtannin B1 is soluble in water and organic solvents, which enhances its applicability in various formulations. Its presence in natural products contributes to the astringent taste and potential health benefits associated with certain herbal remedies and dietary sources. Additionally, research into its potential uses in medicine and food preservation continues to expand, highlighting its significance in both traditional and modern applications. As with many tannins, it may also interact with proteins and other macromolecules, influencing its behavior in biological systems.
Formula:C45H36O18
InChI:InChI=1S/C45H36O18/c46-18-10-27(54)33-31(11-18)62-45(17-3-6-22(49)26(53)9-17)44(59)38(33)36-32(63-45)14-29(56)35-37(39(58)41(61-43(35)36)16-2-5-21(48)25(52)8-16)34-28(55)13-23(50)19-12-30(57)40(60-42(19)34)15-1-4-20(47)24(51)7-15/h1-11,13-14,30,37-41,44,46-59H,12H2/t30-,37+,38-,39-,40-,41-,44-,45+/m1/s1
InChI key:InChIKey=BYSRPHRKESMCPO-LQNPQWRQSA-N
SMILES:O[C@H]1[C@@]2(OC3=C([C@]1(C=4C(O2)=CC(O)=CC4O)[H])C5=C(C(O)=C3)[C@@H]([C@@H](O)[C@H](O5)C6=CC(O)=C(O)C=C6)C7=C8C(C[C@@H](O)[C@H](O8)C9=CC(O)=C(O)C=C9)=C(O)C=C7O)C%10=CC(O)=C(O)C=C%10
Synonyms:- (2R,3R,4S,8S,14R,15R)-2,8-Bis(3,4-dihydroxyphenyl)-4-[(2R,3R)-2-(3,4-dihydroxyphenyl)-3,4-dihydro-3,5,7-trihydroxy-2H-1-benzopyran-8-yl]-3,4-dihydro-8,14-methano-2H,14H-1-benzopyrano[7,8-d][1,3]benzodioxocin-3,5,11,13,15-pentol
- 8,14-Methano-2H,14H-1-benzopyrano[7,8-d][1,3]benzodioxocin-3,5,11,13,15-pentol, 2,8-bis(3,4-dihydroxyphenyl)-4-[(2R,3R)-2-(3,4-dihydroxyphenyl)-3,4-dihydro-3,5,7-trihydroxy-2H-1-benzopyran-8-yl]-3,4-dihydro-, (2R,3R,4S,8S,14R,15R)-
- LDN 0022358
- 8,14-Methano-2H,14H-1-benzopyrano[7,8-d][1,3]benzodioxocin-3,5,11,13,15-pentol, 2,8-bis(3,4-dihydroxyphenyl)-4-[2-(3,4-dihydroxyphenyl)-3,4-dihydro-3,5,7-trihydroxy-2H-1-benzopyran-8-yl]-3,4-dihydro-, [2R-[2α,3α,4β(2R*,3R*),8β,14β,15R*]]-
- Cinnamtannin B1
- Cinnamtannin B1 (constituent of cinnamomum verum bark)
- Cinnamtannin B-1
- LDN0022358
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Cinnamtannin B1
CAS:Aromatic heterocyclic compounds with oxygen hetero-atom(s) only, nesoiFormula:C45H36O18Color and Shape:Light Pink PowderMolecular weight:864.19016Cinnamtannin B-1
CAS:Formula:C45H36O18Purity:≥ 95.0%Color and Shape:Pale brown to brown powder or solidMolecular weight:864.7Cinnamtannin b1
CAS:Oxygen-heterocyclic compoundFormula:C45H36O18Purity:≥ 90.0 % (HPLC)Color and Shape:PowderMolecular weight:864.76Cinnamtannin B-1
CAS:Controlled ProductApplications Cinnamtannin B-1 is a potent antioxidant and Cox-2 inhibitor.
Formula:C45H36O18Color and Shape:NeatMolecular weight:864.756Cinnamtannin B-1
CAS:Cinnamtannin B-1 (LDN 0022358) is an A-type proanthocyanidin contained in several plant species such as Vaccinium vitis-idaea, Laurus nobilis L., CinnamomumFormula:C45H36O18Purity:99.72%Color and Shape:SolidMolecular weight:864.76Cinnamtannin B-1
CAS:Cinnamtannin B-1 is a cytosolic Ca2+ modulator that binds to and inhibits the activity of ATPases, which are enzymes that hydrolyze ATP. This causes an increase in intracellular Ca2+ levels, which leads to altered cell physiology. Cinnamtannin B-1 also inhibits mitochondrial membrane potential and enzyme activities. Cinnamtannin B-1 is a bioactive phytochemical found in cinnamon extract, which has been shown to have anti-obesity effects due to its ability to reduce the number of fat cells. Cinnamtannin B-1 has been shown to inhibit 3T3-L1 preadipocyte differentiation by targeting proteins such as procyanidins.
Formula:C45H36O18Purity:Min. 95%Color and Shape:PowderMolecular weight:864.76 g/molRef: 3D-FC09482
Discontinued product








