CAS 88083-53-8

Oxirane, 2-(3-methoxybutyl)-2,3-dimethyl-

Description:

Oxirane, 2-(3-methoxybutyl)-2,3-dimethyl- is a chemical compound characterized by its epoxide functional group, which is a three-membered cyclic ether. This compound features a methoxybutyl substituent and two methyl groups on the oxirane ring, contributing to its unique structural properties. The presence of the methoxy group enhances its solubility in organic solvents and may influence its reactivity, particularly in nucleophilic substitution reactions. The compound is likely to exhibit moderate volatility and may have a low to moderate boiling point due to its relatively low molecular weight. Additionally, the steric hindrance introduced by the two methyl groups can affect its reactivity and stability. As with many epoxides, it may be reactive towards nucleophiles, making it useful in various chemical synthesis applications, including polymerization and as an intermediate in organic synthesis. Safety data should be consulted for handling and potential hazards, as epoxides can be irritants and may pose health risks if not managed properly.

Formula: C₉H₁₈O₂

InChI: InChI=1S/C9H18O2/c1-7(10-4)5-6-9(3)8(2)11-9/h7-8H,5-6H2,1-4H3

InChI key: YHXFQYSMNCFNHJ-UHFFFAOYSA-N

SMILES: CC1C(O1)(C)CCC(C)OC