CAS 88085-24-9

1,2-Propanediol, 3-chlorodinitro-

Description:

1,2-Propanediol, 3-chlorodinitro- is a chemical compound characterized by its structure, which includes a propane backbone with hydroxyl (-OH) groups and two nitro (-NO2) groups, along with a chlorine atom. This compound is typically a viscous liquid at room temperature and is soluble in water due to the presence of hydroxyl groups, which can form hydrogen bonds. The presence of the nitro groups contributes to its reactivity and potential use in various chemical applications, including as an intermediate in organic synthesis. The chlorine atom may also impart specific properties, such as increased polarity and potential for electrophilic substitution reactions. Safety considerations are important when handling this compound, as it may exhibit toxicity and environmental hazards. Proper storage and handling protocols should be followed to mitigate risks associated with exposure. Overall, 1,2-Propanediol, 3-chlorodinitro- is a compound of interest in both industrial and research settings due to its unique chemical properties.

Formula: C₃H₅ClN₂O₆

InChI: InChI=1S/C3H5ClN2O6/c4-1-2(7)3(8,5(9)10)6(11)12/h2,7-8H,1H2

InChI key: UQUYMFXCGAZHKC-UHFFFAOYSA-N

SMILES: C(C(C([N+](=O)[O-])([N+](=O)[O-])O)O)Cl