CAS 88086-80-0

9H-Xanthene-2-carboxamide, 7-chloro-N-(1-methylethyl)-9-oxo-

Description:

9H-Xanthene-2-carboxamide, 7-chloro-N-(1-methylethyl)-9-oxo- is a chemical compound characterized by its xanthene core structure, which is a polycyclic aromatic compound. This substance features a carboxamide functional group at the 2-position and a chloro substituent at the 7-position, contributing to its reactivity and potential biological activity. The presence of the N-(1-methylethyl) group indicates that it has an isopropyl amine moiety, which can influence its solubility and interaction with biological systems. The 9-oxo group suggests that it has a ketone functionality, which may play a role in its chemical behavior and reactivity. This compound may exhibit properties such as fluorescence or photostability due to its aromatic structure, making it of interest in various fields, including medicinal chemistry and materials science. Its specific applications and biological activities would depend on further studies and characterization, including its synthesis, stability, and interaction with other molecules.

Formula: C₁₇H₁₄ClNO₃

InChI: InChI=1S/C17H14ClNO3/c1-9(2)19-17(21)10-3-5-14-12(7-10)16(20)13-8-11(18)4-6-15(13)22-14/h3-9H,1-2H3,(H,19,21)

InChI key: VVAMRPPKKVDIRX-UHFFFAOYSA-N

SMILES: CC(C)NC(=O)C1=CC2=C(C=C1)OC3=C(C2=O)C=C(C=C3)Cl