CAS 88088-10-2

Butane, 1,1-bis(methylseleno)-

Description:

Butane, 1,1-bis(methylseleno)-, also known by its CAS number 88088-10-2, is an organoselenium compound characterized by the presence of two methylseleno groups attached to a butane backbone. This compound typically exhibits a colorless to pale yellow appearance and is soluble in organic solvents. The presence of selenium in its structure imparts unique chemical properties, including potential reactivity in various organic reactions and biological activities. Organoselenium compounds are often studied for their antioxidant properties and potential applications in pharmaceuticals and agriculture. The methylseleno groups can influence the compound's reactivity, making it of interest in synthetic organic chemistry. However, due to the toxicity associated with selenium compounds, handling and disposal must be conducted with care. Overall, Butane, 1,1-bis(methylseleno)- represents a class of compounds that bridges organic chemistry and biochemistry, with ongoing research into its properties and applications.

Formula: C₆H₁₄Se₂

InChI: InChI=1S/C6H14Se2/c1-4-5-6(7-2)8-3/h6H,4-5H2,1-3H3

InChI key: VGSZCPMSAQZLQZ-UHFFFAOYSA-N

SMILES: CCCC([Se]C)[Se]C