CAS 88089-49-0

1,2,5-Thiadiazol-3(2H)-one, 4-(2-pyridinyl)-

Description:

1,2,5-Thiadiazol-3(2H)-one, 4-(2-pyridinyl)-, with the CAS number 88089-49-0, is a heterocyclic compound characterized by the presence of a thiadiazole ring fused with a pyridine moiety. This compound typically exhibits properties associated with both the thiadiazole and pyridine functional groups, such as potential biological activity and the ability to participate in various chemical reactions. The thiadiazole ring contributes to its stability and reactivity, while the pyridine ring can enhance solubility in polar solvents and influence the compound's electronic properties. This substance may be of interest in medicinal chemistry due to its potential pharmacological applications, including antimicrobial or anti-inflammatory activities. Additionally, its unique structure allows for various modifications, which can lead to the development of derivatives with enhanced properties. Overall, 1,2,5-Thiadiazol-3(2H)-one, 4-(2-pyridinyl)- is a compound of interest in both synthetic and medicinal chemistry contexts.

Formula: C₇H₅N₃OS

InChI: InChI=1S/C7H5N3OS/c11-7-6(9-12-10-7)5-3-1-2-4-8-5/h1-4H,(H,10,11)

InChI key: GQSTUQNXXREKLT-UHFFFAOYSA-N

SMILES: C1=CC=NC(=C1)C2=NSNC2=O