CAS 88089-62-7

Pyrimidine, 2,5-dichloro-, 1-oxide

Description:

Pyrimidine, 2,5-dichloro-, 1-oxide, with the CAS number 88089-62-7, is a heterocyclic organic compound characterized by a pyrimidine ring that features two chlorine substituents at the 2 and 5 positions and an oxide group at the 1 position. This compound is part of the pyrimidine family, which is known for its aromatic properties and is commonly found in various biological molecules, including nucleotides. The presence of chlorine atoms enhances its reactivity and may influence its biological activity, making it of interest in medicinal chemistry and agrochemical applications. The oxide group contributes to its potential as an oxidizing agent. Pyrimidine derivatives are often studied for their roles in pharmaceuticals, as they can exhibit a range of biological activities, including antimicrobial and antiviral properties. Safety data should be consulted for handling and usage, as halogenated compounds can pose environmental and health risks. Overall, this compound exemplifies the diverse chemistry of pyrimidines and their derivatives.

Formula: C₄H₂Cl₂N₂O

InChI: InChI=1S/C4H2Cl2N2O/c5-3-1-7-4(6)8(9)2-3/h1-2H

InChI key: KEGJBQTVICZYRV-UHFFFAOYSA-N

SMILES: C1=C(C=[N+](C(=N1)Cl)[O-])Cl