CAS 88090-56-6

4-[(2-sulfanylethyl)amino]pyridine-2,6-dicarboxylic acid

Description:

4-[(2-Sulfanylethyl)amino]pyridine-2,6-dicarboxylic acid, with the CAS number 88090-56-6, is an organic compound characterized by its pyridine ring structure substituted with two carboxylic acid groups and a sulfanylethylamino group. This compound features a pyridine core, which contributes to its aromatic properties and potential for forming hydrogen bonds. The presence of the carboxylic acid groups indicates that it can act as a weak acid, capable of donating protons in solution, and may participate in various chemical reactions, including esterification and amidation. The sulfanylethylamino group introduces a thiol functionality, which can enhance the compound's reactivity and potential for forming disulfide bonds. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its solubility and stability in different solvents can vary, influenced by the functional groups present. Overall, this compound's unique structure and functional groups suggest potential applications in medicinal chemistry and materials science.

Formula: C₉H₁₀N₂O₄S

InChI: InChI=1/C9H10N2O4S/c12-8(13)6-3-5(10-1-2-16)4-7(11-6)9(14)15/h3-4,16H,1-2H2,(H,10,11)(H,12,13)(H,14,15)

2,6-Pyridinedicarboxylicacid, 4-[(2-mercaptoethyl)amino]-

CAS: 88090-56-6

Formula: C₉H₁₀N₂O₄S

Molecular weight: 242.2517

Ref: IN-DA004EKD