CAS 88097-86-3
:2-{[(8-methyl-8-azabicyclo[3.2.1]oct-3-yl)oxy](phenyl)methyl}aniline
Description:
2-{[(8-methyl-8-azabicyclo[3.2.1]oct-3-yl)oxy](phenyl)methyl}aniline, with the CAS number 88097-86-3, is a chemical compound characterized by its complex bicyclic structure and the presence of both an aniline and a phenyl group. This compound features a bicyclic amine, which contributes to its potential biological activity, particularly in pharmacological contexts. The presence of the phenyl group enhances its lipophilicity, potentially influencing its interaction with biological membranes and receptors. The compound's structure suggests it may exhibit properties such as being a ligand for certain receptors or enzymes, making it of interest in medicinal chemistry. Additionally, the azabicyclo structure may impart unique conformational characteristics, affecting its binding affinity and selectivity. Overall, this compound's unique structural features may lead to diverse applications in drug development and research, particularly in areas targeting neurological or psychological conditions. However, specific biological activities and safety profiles would require further empirical investigation.
Formula:C21H26N2O
InChI:InChI=1/C21H26N2O/c1-23-16-11-12-17(23)14-18(13-16)24-21(15-7-3-2-4-8-15)19-9-5-6-10-20(19)22/h2-10,16-18,21H,11-14,22H2,1H3
SMILES:CN1C2CCC1CC(C2)OC(c1ccccc1)c1ccccc1N
Synonyms:- Benzenamine, 2-[[(8-Methyl-8-Azabicyclo[3.2.1]Oct-3-Yl)Oxy]Phenylmethyl]-
- 2-{[(8-Methyl-8-azabicyclo[3.2.1]oct-3-yl)oxy](phenyl)methyl}aniline
- [Synonyms]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
