CAS 88099-35-8
:(5R,6E,8Z,10E,12S)-5,12-dihydroxyicosa-6,8,10-trienoic acid
Description:
The chemical substance known as (5R,6E,8Z,10E,12S)-5,12-dihydroxyicosa-6,8,10-trienoic acid, with the CAS number 88099-35-8, is a polyunsaturated fatty acid characterized by its multiple double bonds and hydroxyl groups. This compound features a long carbon chain, specifically 20 carbon atoms, which is typical for fatty acids. The presence of hydroxyl groups at the 5th and 12th positions contributes to its hydrophilic properties, while the multiple double bonds introduce significant unsaturation, affecting its reactivity and biological functions. This structure allows it to participate in various biochemical pathways, including those related to inflammation and cell signaling. The specific stereochemistry indicated by the R and S designations suggests that this molecule can exhibit unique interactions with biological receptors, potentially influencing its physiological effects. Overall, this compound is of interest in fields such as biochemistry and pharmacology, particularly in the study of lipid metabolism and the development of therapeutic agents.
Formula:C20H34O4
InChI:InChI=1/C20H34O4/c1-2-3-4-5-6-9-13-18(21)14-10-7-8-11-15-19(22)16-12-17-20(23)24/h7-8,10-11,14-15,18-19,21-22H,2-6,9,12-13,16-17H2,1H3,(H,23,24)/b8-7-,14-10+,15-11+/t18-,19-/m0/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Leukotriene B3
CAS:LTB3, a LTA3-derived leukotriene, matches LTB4's inflammation effect but is 5x weaker in neutrophil chemotaxis.Formula:C20H34O4Color and Shape:SolidMolecular weight:338.488LTB3 (Leukotriene B3)
CAS:Controlled ProductFormula:C20H34O4Color and Shape:NeatMolecular weight:338.482

