CAS 88099-67-6
:methyl N,N-dibenzyl-L-serinate
Description:
Methyl N,N-dibenzyl-L-serinate is an organic compound characterized by its structure, which includes a serine derivative with two benzyl groups attached to the nitrogen atom. This compound typically exhibits properties associated with amino acids and esters, such as being polar and capable of forming hydrogen bonds due to the presence of the serine moiety. It is likely to be soluble in organic solvents, while its solubility in water may vary depending on the specific conditions. The presence of the benzyl groups can influence its reactivity and stability, potentially making it a useful intermediate in organic synthesis or pharmaceutical applications. Additionally, the chirality of the L-serine component may impart specific biological activities, making this compound of interest in medicinal chemistry. Overall, methyl N,N-dibenzyl-L-serinate is a versatile compound with potential applications in various fields, including drug development and chemical research.
Formula:C18H21NO3
InChI:InChI=1/C18H21NO3/c1-22-18(21)17(14-20)19(12-15-8-4-2-5-9-15)13-16-10-6-3-7-11-16/h2-11,17,20H,12-14H2,1H3/t17-/m0/s1
SMILES:COC(=O)[C@H](CO)N(Cc1ccccc1)Cc1ccccc1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
