CAS 881008-98-6

2,5-Dimethyl-4-thiazolemethanol

Description:

2,5-Dimethyl-4-thiazolemethanol is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen. This compound features two methyl groups at the 2 and 5 positions of the thiazole ring, contributing to its unique properties. The presence of a hydroxymethyl group at the 4 position enhances its reactivity and solubility in polar solvents. Typically, compounds like this may exhibit biological activity, making them of interest in pharmaceutical and agrochemical research. The thiazole moiety is known for its role in various biochemical processes, and derivatives can show antimicrobial or antifungal properties. Additionally, the compound's structure suggests potential applications in organic synthesis and material science. As with many thiazole derivatives, the stability and reactivity can be influenced by the substituents on the ring, which can affect its interactions in biological systems or chemical reactions. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₆H₉NOS

InChI: InChI=1S/C6H9NOS/c1-4-6(3-8)7-5(2)9-4/h8H,3H2,1-2H3

InChI key: InChIKey=ZLBOUWDBGZPMTR-UHFFFAOYSA-N

SMILES: C(O)C1=C(C)SC(C)=N1

Synonyms:

• (Dimethyl-1,3-thiazol-4-yl)methanol
• 4-Thiazolemethanol, 2,5-dimethyl-
• 4-Thiazolemethanol, 2,5-dimethyl-
• (2,5-Dimethyl-1,3-thiazol-4-yl)methanol
• 2,5-Dimethyl-4-thiazolemethanol