CAS 881037-88-3
:2-Bromo-10-(3-chloropropyl)-9(10H)-acridinone
Description:
2-Bromo-10-(3-chloropropyl)-9(10H)-acridinone is a synthetic organic compound characterized by its acridine backbone, which is a fused ring system known for its aromatic properties. The presence of a bromine atom at the 2-position and a 3-chloropropyl substituent at the 10-position contributes to its unique reactivity and potential biological activity. This compound may exhibit properties such as fluorescence due to the acridine structure, making it useful in various applications, including medicinal chemistry and as a fluorescent probe. The chloropropyl group can serve as a site for further chemical modifications, enhancing its versatility in synthetic pathways. Additionally, the compound's structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. As with many acridine derivatives, it may also possess antimicrobial or anticancer properties, although specific biological activities would need to be evaluated through experimental studies. Safety and handling precautions should be observed due to the presence of halogenated substituents, which can influence toxicity and environmental impact.
Formula:C16H13BrClNO
InChI:InChI=1S/C16H13BrClNO/c17-11-6-7-15-13(10-11)16(20)12-4-1-2-5-14(12)19(15)9-3-8-18/h1-2,4-7,10H,3,8-9H2
InChI key:InChIKey=KSXQAUVJMXVHOO-UHFFFAOYSA-N
SMILES:C(CCCl)N1C=2C(C(=O)C=3C1=CC=CC3)=CC(Br)=CC2
Synonyms:- 2-Bromo-10-(3-chloropropyl)-9(10H)-acridinone
- 9(10H)-Acridinone, 2-bromo-10-(3-chloropropyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
