
CAS 881040-03-5
:6-(4-Bromophenyl)-2-(4-fluorophenyl)imidazo[2,1-b]thiazole
Description:
6-(4-Bromophenyl)-2-(4-fluorophenyl)imidazo[2,1-b]thiazole is a heterocyclic compound characterized by its imidazo-thiazole core, which incorporates both bromine and fluorine substituents on phenyl rings. This compound typically exhibits a molecular structure that contributes to its potential biological activity, making it of interest in medicinal chemistry. The presence of the bromine and fluorine atoms can influence its electronic properties, solubility, and reactivity, which are crucial for its interaction with biological targets. Additionally, the imidazo-thiazole framework is known for its diverse pharmacological properties, including antimicrobial and anticancer activities. The compound's stability, melting point, and solubility can vary based on the specific conditions and solvents used. Its synthesis often involves multi-step organic reactions, and it may be analyzed using techniques such as NMR spectroscopy, mass spectrometry, and X-ray crystallography to confirm its structure and purity. Overall, this compound represents a significant area of research in the development of new therapeutic agents.
Formula:C17H10BrFN2S
InChI:InChI=1S/C17H10BrFN2S/c18-13-5-1-11(2-6-13)15-9-21-10-16(22-17(21)20-15)12-3-7-14(19)8-4-12/h1-10H
InChI key:InChIKey=FZEYIIBKVJONEW-UHFFFAOYSA-N
SMILES:BrC1=CC=C(C=2N=C3N(C=C(S3)C4=CC=C(F)C=C4)C2)C=C1
Synonyms:- 6-(4-Bromophenyl)-2-(4-fluorophenyl)imidazo[2,1-b]thiazole
- Imidazo[2,1-b]thiazole, 6-(4-bromophenyl)-2-(4-fluorophenyl)-
- 6-(4-BROMOPHENYL)-2-(4-FLUOROPHENYL)IMIDAZO[2,1-B][1,3]THIAZOLE
- 6-(4-BROMO-PHENYL)-2-(4-FLUORO-PHENYL)-IMIDAZO[2,1-B]THIAZOLE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.