CAS 881040-30-8

5-Bromo-2-(4-chlorophenyl)-1H-indole

Description:

5-Bromo-2-(4-chlorophenyl)-1H-indole is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This particular compound features a bromine atom at the 5-position and a 4-chlorophenyl group at the 2-position of the indole ring, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of halogen substituents, such as bromine and chlorine, can influence its reactivity, making it a potential candidate for various chemical reactions, including electrophilic substitutions. Additionally, compounds like this one are often studied for their biological activities, including potential pharmaceutical applications, due to the indole moiety's prevalence in many biologically active molecules. Safety data should be consulted for handling and storage, as halogenated compounds can pose health risks.

Formula: C₁₄H₉BrClN

InChI: InChI=1S/C14H9BrClN/c15-11-3-6-13-10(7-11)8-14(17-13)9-1-4-12(16)5-2-9/h1-8,17H

InChI key: InChIKey=NAIYVMRIKUGKNC-UHFFFAOYSA-N

SMILES: ClC1=CC=C(C=2NC=3C(C2)=CC(Br)=CC3)C=C1

Synonyms:

• 5-Bromo-2-(4-chlorophenyl)indole
• 1H-Indole, 5-bromo-2-(4-chlorophenyl)-
• 5-Bromo-2-(4-chlorophenyl)-1H-indole