CAS 881040-32-0: 2-(4-Chlorophenyl)-5-fluoro-1H-indole

Description:2-(4-Chlorophenyl)-5-fluoro-1H-indole, with the CAS number 881040-32-0, is a synthetic organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound features a 4-chlorophenyl group and a fluorine atom at specific positions on the indole framework, contributing to its unique chemical properties. The presence of the chlorine and fluorine substituents can influence the compound's reactivity, solubility, and biological activity, making it of interest in medicinal chemistry and drug development. Typically, compounds like this may exhibit various pharmacological activities, including potential anti-cancer or anti-inflammatory properties, although specific biological data would depend on empirical studies. The compound is likely to be a solid at room temperature and may require careful handling due to the presence of halogenated groups, which can affect its environmental stability and toxicity. As with many synthetic compounds, its synthesis and application would be guided by safety protocols and regulatory considerations.

Formula:C₁₄H₉ClFN

InChI:InChI=1S/C14H9ClFN/c15-11-3-1-9(2-4-11)14-8-10-7-12(16)5-6-13(10)17-14/h1-8,17H

InChI key:InChIKey=UCZBRWNBWDXXGB-UHFFFAOYSA-N

SMILES:FC1=CC=C2NC(=CC2=C1)C=3C=CC(Cl)=CC3