CAS 881040-51-3
:2-(1,3-Benzodioxol-5-yl)-8-methylimidazo[1,2-a]pyridine
Description:
2-(1,3-Benzodioxol-5-yl)-8-methylimidazo[1,2-a]pyridine, identified by its CAS number 881040-51-3, is a chemical compound that belongs to the class of imidazopyridines. This compound features a fused bicyclic structure that includes an imidazole ring and a pyridine ring, which contributes to its potential biological activity. The presence of the benzodioxole moiety enhances its chemical properties, potentially influencing its reactivity and interactions with biological targets. Typically, compounds of this nature may exhibit various pharmacological activities, including anti-cancer properties, due to their structural similarity to known bioactive molecules. The methyl group at the 8-position of the imidazo ring may also affect its lipophilicity and solubility, which are critical factors in drug design and development. As with many heterocyclic compounds, the specific characteristics such as melting point, solubility, and spectral properties would depend on the compound's purity and the conditions under which they are measured. Further studies would be necessary to fully elucidate its biological effects and potential applications in medicinal chemistry.
Formula:C15H12N2O2
InChI:InChI=1S/C15H12N2O2/c1-10-3-2-6-17-8-12(16-15(10)17)11-4-5-13-14(7-11)19-9-18-13/h2-8H,9H2,1H3
InChI key:InChIKey=UAUHKCLMVOLVKM-UHFFFAOYSA-N
SMILES:CC=1C2=NC(=CN2C=CC1)C=3C=C4C(=CC3)OCO4
Synonyms:- Imidazo[1,2-a]pyridine, 2-(1,3-benzodioxol-5-yl)-8-methyl-
- 2-(1,3-Benzodioxol-5-yl)-8-methylimidazo[1,2-a]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.