CAS 881040-64-8

6-Chloro-2-(2,5-dimethylphenyl)imidazo[1,2-a]pyridine

Description:

6-Chloro-2-(2,5-dimethylphenyl)imidazo[1,2-a]pyridine is a chemical compound characterized by its imidazo[1,2-a]pyridine core, which is a bicyclic structure containing both an imidazole and a pyridine ring. The presence of a chlorine atom at the 6-position and a 2,5-dimethylphenyl group at the 2-position contributes to its unique chemical properties and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry and drug development. The presence of the dimethylphenyl group may enhance lipophilicity, influencing its pharmacokinetic properties. As with many heterocyclic compounds, it may participate in various chemical reactions, including electrophilic substitutions and nucleophilic attacks, depending on the functional groups present. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings.

Formula: C₁₅H₁₃ClN₂

InChI: InChI=1S/C15H13ClN2/c1-10-3-4-11(2)13(7-10)14-9-18-8-12(16)5-6-15(18)17-14/h3-9H,1-2H3

InChI key: InChIKey=QAIQHHDRIYAPKH-UHFFFAOYSA-N

SMILES: CC1=C(C=2N=C3N(C2)C=C(Cl)C=C3)C=C(C)C=C1

Synonyms:

• 6-Chloro-2-(2,5-dimethylphenyl)imidazo[1,2-a]pyridine
• Imidazo[1,2-a]pyridine, 6-chloro-2-(2,5-dimethylphenyl)-