CAS 881040-67-1
:1-(Chlorophenylmethyl)-2-(trifluoromethyl)benzene
Description:
1-(Chlorophenylmethyl)-2-(trifluoromethyl)benzene, identified by its CAS number 881040-67-1, is an organic compound characterized by its complex aromatic structure. This substance features a chlorophenyl group and a trifluoromethyl group attached to a benzene ring, which contributes to its unique chemical properties. The presence of the chlorine atom introduces electronegative characteristics, potentially influencing the compound's reactivity and solubility in various solvents. The trifluoromethyl group is known for its strong electron-withdrawing effects, which can enhance the compound's stability and alter its interaction with other chemical species. This compound may exhibit significant hydrophobicity due to its aromatic nature and the presence of fluorine atoms, which can affect its behavior in biological systems and environmental contexts. Additionally, its structural features suggest potential applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. However, specific safety and handling guidelines should be followed due to the presence of halogenated groups, which may pose environmental and health risks.
Formula:C14H10ClF3
InChI:InChI=1S/C14H10ClF3/c15-13(10-6-2-1-3-7-10)11-8-4-5-9-12(11)14(16,17)18/h1-9,13H
InChI key:InChIKey=XVPZKCBHUWFJHK-UHFFFAOYSA-N
SMILES:C(Cl)(C1=C(C(F)(F)F)C=CC=C1)C2=CC=CC=C2
Synonyms:- 1-(Chlorophenylmethyl)-2-(trifluoromethyl)benzene
- Benzene, 1-(chlorophenylmethyl)-2-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.