CymitQuimica logo

CAS 881040-70-6

:

Hexahydro-2-[(3-methyl-4-pyridinyl)methyl]-1H-azepine

Description:
Hexahydro-2-[(3-methyl-4-pyridinyl)methyl]-1H-azepine, identified by its CAS number 881040-70-6, is a chemical compound characterized by its bicyclic structure, which includes a saturated azepine ring and a pyridine moiety. The presence of the 3-methyl-4-pyridinyl group contributes to its potential biological activity, as pyridine derivatives are often associated with various pharmacological properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. Its molecular structure suggests it may exhibit basic properties due to the nitrogen atoms in the azepine and pyridine rings. The compound's solubility can vary, often being soluble in organic solvents while having limited solubility in water. Hexahydro-2-[(3-methyl-4-pyridinyl)methyl]-1H-azepine may be of interest in medicinal chemistry and drug development, particularly in the context of exploring its interactions with biological targets. As with any chemical substance, proper handling and safety protocols should be observed.
Formula:C13H20N2
InChI:InChI=1S/C13H20N2/c1-11-10-14-8-6-12(11)9-13-5-3-2-4-7-15-13/h6,8,10,13,15H,2-5,7,9H2,1H3
InChI key:InChIKey=OSNDCBRJTAIDGW-UHFFFAOYSA-N
SMILES:C(C=1C(C)=CN=CC1)C2CCCCCN2
Synonyms:
  • Hexahydro-2-[(3-Methyl-4-Pyridinyl)Methyl]-1H-Azepine
  • 1H-Azepine, hexahydro-2-[(3-methyl-4-pyridinyl)methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.