CymitQuimica logo

CAS 881040-72-8

:

1-[2-(3,4-Diethoxyphenyl)ethyl]-5-oxo-3-pyrrolidinecarboxylic acid

Description:
1-[2-(3,4-Diethoxyphenyl)ethyl]-5-oxo-3-pyrrolidinecarboxylic acid, with the CAS number 881040-72-8, is a chemical compound characterized by its unique structure that includes a pyrrolidine ring and a carboxylic acid functional group. This compound features a diethoxyphenyl moiety, which contributes to its potential biological activity and solubility properties. The presence of the carbonyl group (5-oxo) enhances its reactivity, making it a candidate for various chemical transformations. The pyrrolidine ring is known for its role in medicinal chemistry, often associated with neuroactive compounds. This substance may exhibit interesting pharmacological properties, although specific biological activities would require further investigation. Its synthesis and characterization would typically involve standard organic chemistry techniques, including NMR and mass spectrometry for confirmation of structure. As with many organic compounds, safety and handling precautions should be observed, particularly due to the potential for biological activity and the presence of functional groups that may influence reactivity.
Formula:C17H23NO5
InChI:InChI=1S/C17H23NO5/c1-3-22-14-6-5-12(9-15(14)23-4-2)7-8-18-11-13(17(20)21)10-16(18)19/h5-6,9,13H,3-4,7-8,10-11H2,1-2H3,(H,20,21)
InChI key:InChIKey=FURMKQFTMVIACL-UHFFFAOYSA-N
SMILES:O(CC)C1=C(OCC)C=CC(CCN2C(=O)CC(C(O)=O)C2)=C1
Synonyms:
  • 3-Pyrrolidinecarboxylic acid, 1-[2-(3,4-diethoxyphenyl)ethyl]-5-oxo-
  • 1-[2-(3,4-Diethoxyphenyl)ethyl]-5-oxo-3-pyrrolidinecarboxylic acid
  • 1-[2-(3,4-DIETHOXY-PHENYL)-ETHYL]-5-OXO-PYRROLIDINE-3-CARBOXYLIC ACID
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.