CAS 881041-00-5
:3-(2-Furanyl)-5-(methylthio)-4H-1,2,4-triazol-4-amine
Description:
3-(2-Furanyl)-5-(methylthio)-4H-1,2,4-triazol-4-amine is a chemical compound characterized by its unique structural features, which include a triazole ring, a furan moiety, and a methylthio group. The presence of the triazole ring suggests potential applications in pharmaceuticals, particularly as a scaffold for drug development due to its ability to form hydrogen bonds and engage in π-π stacking interactions. The furan ring contributes to the compound's aromaticity and may enhance its biological activity, while the methylthio group can influence solubility and reactivity. This compound may exhibit various biological activities, including antifungal or antimicrobial properties, making it of interest in medicinal chemistry. Its molecular structure allows for potential interactions with biological targets, which can be explored in drug design. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in both laboratory and industrial applications. Overall, 3-(2-Furanyl)-5-(methylthio)-4H-1,2,4-triazol-4-amine represents a versatile compound with potential utility in various chemical and biological contexts.
Formula:C7H8N4OS
InChI:InChI=1S/C7H8N4OS/c1-13-7-10-9-6(11(7)8)5-3-2-4-12-5/h2-4H,8H2,1H3
InChI key:InChIKey=COVMNJKTCSHTIX-UHFFFAOYSA-N
SMILES:NN1C(=NN=C1SC)C2=CC=CO2
Synonyms:- 4H-1,2,4-Triazol-4-amine, 3-(2-furanyl)-5-(methylthio)-
- 3-(2-Furanyl)-5-(methylthio)-4H-1,2,4-triazol-4-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.