CAS 881041-08-3

Methyl 2-amino-5-ethyl-4-methyl-3-thiophenecarboxylate

Description:

Methyl 2-amino-5-ethyl-4-methyl-3-thiophenecarboxylate is an organic compound characterized by its thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. This compound features an amino group (-NH2) and a carboxylate ester functional group (-COOCH3), contributing to its reactivity and potential applications in organic synthesis. The presence of ethyl and methyl substituents on the thiophene ring enhances its lipophilicity and may influence its biological activity. The molecular structure suggests that it could participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions, making it of interest in medicinal chemistry and materials science. Additionally, the compound's unique combination of functional groups may impart specific properties, such as solubility in organic solvents and potential interactions with biological targets. Overall, Methyl 2-amino-5-ethyl-4-methyl-3-thiophenecarboxylate represents a versatile building block in the synthesis of more complex molecules.

Formula: C₉H₁₃NO₂S

InChI: InChI=1S/C9H13NO2S/c1-4-6-5(2)7(8(10)13-6)9(11)12-3/h4,10H2,1-3H3

InChI key: InChIKey=OVYMLCQVZXBMKV-UHFFFAOYSA-N

SMILES: C(OC)(=O)C=1C(C)=C(CC)SC1N

Synonyms:

• 3-Thiophenecarboxylic acid, 2-amino-5-ethyl-4-methyl-, methyl ester
• Methyl 2-amino-5-ethyl-4-methyl-3-thiophenecarboxylate
• 2-Amino-5-ethyl-4-methyl-thiophene-3-carboxylic acid methyl ester