CAS 881041-10-7

5-[(3-Formylphenoxy)methyl]-2-furancarboxylic acid

Description:

5-[(3-Formylphenoxy)methyl]-2-furancarboxylic acid is an organic compound characterized by its unique structure, which includes a furan ring and a phenyl group with an aldehyde functional group. This compound features a carboxylic acid group, contributing to its acidic properties. The presence of the furan ring suggests potential reactivity in various organic reactions, such as electrophilic substitution or polymerization. The aldehyde group in the phenyl moiety can participate in condensation reactions, making it versatile in synthetic applications. Additionally, the compound may exhibit biological activity, as many furan derivatives are known for their pharmacological properties. Its solubility characteristics would typically depend on the pH of the solution, with the carboxylic acid group influencing its solubility in polar solvents. Overall, this compound's structural features suggest potential utility in medicinal chemistry and materials science, although specific applications would depend on further research and exploration of its properties.

Formula: C₁₃H₁₀O₅

InChI: InChI=1S/C13H10O5/c14-7-9-2-1-3-10(6-9)17-8-11-4-5-12(18-11)13(15)16/h1-7H,8H2,(H,15,16)

InChI key: InChIKey=BCOINUORALKLTA-UHFFFAOYSA-N

SMILES: C(OC1=CC(C=O)=CC=C1)C=2OC(C(O)=O)=CC2

Synonyms:

• 2-Furancarboxylic acid, 5-[(3-formylphenoxy)methyl]-
• 5-[(3-Formylphenoxy)methyl]-2-furancarboxylic acid