CAS 881041-11-8

2-(2-Formyl-1H-pyrrol-1-yl)-5-nitrobenzonitrile

Description:

2-(2-Formyl-1H-pyrrol-1-yl)-5-nitrobenzonitrile is an organic compound characterized by its complex molecular structure, which includes a pyrrole ring and a nitro-substituted benzonitrile moiety. The presence of the formyl group indicates that it can participate in various chemical reactions, such as condensation and reduction. The nitro group contributes to the compound's electron-withdrawing properties, which can influence its reactivity and stability. This compound is likely to exhibit moderate solubility in organic solvents due to its polar functional groups, while its aromatic components may provide some degree of hydrophobic character. Additionally, the presence of both the formyl and nitrile groups suggests potential applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals. As with many organic compounds, safety precautions should be taken when handling this substance, as it may pose health risks or environmental hazards. Overall, 2-(2-Formyl-1H-pyrrol-1-yl)-5-nitrobenzonitrile is a versatile compound with potential utility in various chemical applications.

Formula: C₁₂H₇N₃O₃

InChI: InChI=1S/C12H7N3O3/c13-7-9-6-10(15(17)18)3-4-12(9)14-5-1-2-11(14)8-16/h1-6,8H

InChI key: InChIKey=COCQHXMIXIRPNZ-UHFFFAOYSA-N

SMILES: C(#N)C1=C(C=CC(N(=O)=O)=C1)N2C(C=O)=CC=C2

Synonyms:

• 2-(2-Formyl-1H-pyrrol-1-yl)-5-nitrobenzonitrile
• Benzonitrile, 2-(2-formyl-1H-pyrrol-1-yl)-5-nitro-