CymitQuimica logo

CAS 881041-22-1

:

Methyl 6-propoxy-1H-indole-2-carboxylate

Description:
Methyl 6-propoxy-1H-indole-2-carboxylate is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This particular compound features a methyl ester functional group, contributing to its reactivity and solubility properties. The presence of a propoxy group at the 6-position of the indole ring enhances its lipophilicity, potentially influencing its biological activity and interaction with various biological targets. The carboxylate moiety is significant for its role in esterification and can participate in various chemical reactions, including hydrolysis and transesterification. Methyl 6-propoxy-1H-indole-2-carboxylate may be of interest in medicinal chemistry and drug development due to its structural features, which could lead to the discovery of novel pharmacological agents. Its CAS number, 881041-22-1, allows for precise identification and retrieval of information regarding its properties, synthesis, and applications in scientific literature.
Formula:C13H15NO3
InChI:InChI=1S/C13H15NO3/c1-3-6-17-10-5-4-9-7-12(13(15)16-2)14-11(9)8-10/h4-5,7-8,14H,3,6H2,1-2H3
InChI key:InChIKey=LKIGYMCFNJXBLY-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1NC=2C(C1)=CC=C(OCCC)C2
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.