CAS 881041-43-6

Methyl 1-(3,4-dichlorophenyl)-5-(3,4-dimethylphenyl)-2-methyl-1H-pyrrole-3-carboxylate

Description:

Methyl 1-(3,4-dichlorophenyl)-5-(3,4-dimethylphenyl)-2-methyl-1H-pyrrole-3-carboxylate, identified by its CAS number 881041-43-6, is a synthetic organic compound characterized by its complex molecular structure, which includes a pyrrole ring substituted with various aromatic groups. This compound typically exhibits properties associated with pyrrole derivatives, such as potential biological activity and solubility in organic solvents. The presence of dichlorophenyl and dimethylphenyl groups suggests that it may possess significant lipophilicity, influencing its interaction with biological systems. Additionally, the methyl ester functional group indicates that it can undergo hydrolysis to form the corresponding carboxylic acid. Such compounds are often investigated for their pharmacological properties, including anti-inflammatory or anticancer activities. The specific characteristics, such as melting point, boiling point, and spectral data, would require empirical measurement or literature reference for precise values. Overall, this compound represents a class of molecules with potential applications in medicinal chemistry and material science.

Formula: C₂₁H₁₉Cl₂NO₂

InChI: InChI=1S/C21H19Cl2NO2/c1-12-5-6-15(9-13(12)2)20-11-17(21(25)26-4)14(3)24(20)16-7-8-18(22)19(23)10-16/h5-11H,1-4H3

InChI key: InChIKey=RFGZRZFJYXZZHG-UHFFFAOYSA-N

SMILES: CC=1N(C(=CC1C(OC)=O)C2=CC(C)=C(C)C=C2)C3=CC(Cl)=C(Cl)C=C3

Synonyms:

• 1H-Pyrrole-3-carboxylic acid, 1-(3,4-dichlorophenyl)-5-(3,4-dimethylphenyl)-2-methyl-, methyl ester
• Methyl 1-(3,4-dichlorophenyl)-5-(3,4-dimethylphenyl)-2-methyl-1H-pyrrole-3-carboxylate