CAS 881041-47-0
:2-(2,5-Dimethylphenyl)imidazo[1,2-a]pyrimidine
Description:
2-(2,5-Dimethylphenyl)imidazo[1,2-a]pyrimidine is a heterocyclic organic compound characterized by its imidazo and pyrimidine rings fused together, along with a substituted phenyl group. This compound features a dimethyl substitution on the phenyl ring, which can influence its electronic properties and steric hindrance. Typically, compounds of this class exhibit interesting biological activities, making them of interest in medicinal chemistry. The presence of nitrogen atoms in the imidazo and pyrimidine rings contributes to the compound's potential for forming hydrogen bonds, which can enhance its interactions with biological targets. Additionally, the molecular structure may impart specific solubility and stability characteristics, affecting its behavior in various solvents and under different conditions. The compound's unique structure may also lead to specific reactivity patterns, making it a candidate for further research in drug development or as a chemical probe in biological studies. As with many organic compounds, its properties can be influenced by factors such as temperature, pH, and the presence of other chemical species.
Formula:C14H13N3
InChI:InChI=1S/C14H13N3/c1-10-4-5-11(2)12(8-10)13-9-17-7-3-6-15-14(17)16-13/h3-9H,1-2H3
InChI key:InChIKey=XDGXLWAETKHBJF-UHFFFAOYSA-N
SMILES:CC1=C(C2=CN3C(=N2)N=CC=C3)C=C(C)C=C1
Synonyms:- Imidazo[1,2-a]pyrimidine, 2-(2,5-dimethylphenyl)-
- 2-(2,5-Dimethylphenyl)imidazo[1,2-a]pyrimidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.