CAS 881041-63-0

Ethyl 3-amino-5-(1-naphthalenyl)-2-thiophenecarboxylate

Description:

Ethyl 3-amino-5-(1-naphthalenyl)-2-thiophenecarboxylate is a chemical compound characterized by its unique structure, which includes an ethyl ester group, an amino group, and a thiophene ring substituted with a naphthalene moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as potential biological activity and solubility in organic solvents. The presence of the amino group suggests it may participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. The thiophene ring contributes to its electronic properties, potentially making it useful in organic electronics or as a precursor in synthetic chemistry. Additionally, the naphthalene substitution can enhance its stability and hydrophobic characteristics. Overall, this compound may have applications in pharmaceuticals, agrochemicals, or materials science, depending on its specific reactivity and interactions in various environments. Further studies would be necessary to fully elucidate its properties and potential applications.

Formula: C₁₇H₁₅NO₂S

InChI: InChI=1S/C17H15NO2S/c1-2-20-17(19)16-14(18)10-15(21-16)13-9-5-7-11-6-3-4-8-12(11)13/h3-10H,2,18H2,1H3

InChI key: InChIKey=IMCHHDKFVZIROW-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C=1SC(C=2C3=C(C=CC2)C=CC=C3)=CC1N

Synonyms:

• 2-Thiophenecarboxylic acid, 3-amino-5-(1-naphthalenyl)-, ethyl ester
• Ethyl 3-amino-5-(1-naphthalenyl)-2-thiophenecarboxylate