CAS 88105-16-2

Benzoic acid, 2-methoxy-, 2-[(2-methoxybenzoyl)amino]ethyl ester

Description:

Benzoic acid, 2-methoxy-, 2-[(2-methoxybenzoyl)amino]ethyl ester, identified by CAS number 88105-16-2, is an organic compound characterized by its ester functional group and the presence of methoxy substituents. This compound features a benzoic acid moiety, which contributes to its aromatic properties, and an aminoethyl chain that enhances its solubility and reactivity. The methoxy groups provide additional electron-donating effects, influencing the compound's chemical behavior and potential interactions. Typically, such esters exhibit moderate polarity, making them soluble in organic solvents while having limited solubility in water. The presence of the amino group suggests potential for hydrogen bonding, which can affect the compound's physical properties, such as melting and boiling points. This compound may have applications in pharmaceuticals or as an intermediate in organic synthesis due to its structural characteristics. However, specific reactivity and stability can vary based on environmental conditions and the presence of other functional groups in a reaction mixture.

Formula: C₁₈H₁₉NO₅

InChI: InChI=1S/C18H19NO5/c1-22-15-9-5-3-7-13(15)17(20)19-11-12-24-18(21)14-8-4-6-10-16(14)23-2/h3-10H,11-12H2,1-2H3,(H,19,20)

InChI key: InChIKey=ICDUPPLKOBXSAM-UHFFFAOYSA-N

SMILES: C(NCCOC(=O)C1=C(OC)C=CC=C1)(=O)C2=C(OC)C=CC=C2

Synonyms:

• Benzoic acid, 2-methoxy-, 2-[(2-methoxybenzoyl)amino]ethyl ester
• 2-[(2-Methoxybenzoyl)amino]ethyl 2-methoxybenzoate

Benzoic acid, 2-methoxy-, 2-[(2-methoxybenzoyl)amino]ethyl ester

CAS: 88105-16-2

Formula: C₁₈H₁₉NO₅

Molecular weight: 329.3472

Ref: IN-DA004EA6