CAS 88105-29-7
:Notoginsenoside Fe
Description:
Notoginsenoside Fe is a saponin compound derived from Panax notoginseng, a traditional medicinal plant known for its various health benefits. This compound is characterized by its complex glycosidic structure, which contributes to its biological activity. Notoginsenoside Fe exhibits properties such as anti-inflammatory, antioxidant, and neuroprotective effects, making it of interest in pharmacological research. It is often studied for its potential in treating cardiovascular diseases and enhancing cognitive function. The substance is typically soluble in organic solvents and has limited solubility in water, which is common for many saponins. Its mechanism of action may involve modulation of signaling pathways and interaction with cellular receptors, although further research is needed to fully elucidate its pharmacodynamics. As with many natural products, the extraction and purification processes can influence its efficacy and bioavailability, highlighting the importance of standardized methods in its study and application. Overall, Notoginsenoside Fe represents a promising area of research in natural product chemistry and medicinal applications.
Formula:C47H80O17
InChI:InChI=1S/C47H80O17/c1-22(2)10-9-14-47(8,64-42-39(58)36(55)34(53)27(62-42)21-59-40-37(56)33(52)26(20-49)60-40)23-11-16-46(7)31(23)24(50)18-29-44(5)15-13-30(43(3,4)28(44)12-17-45(29,46)6)63-41-38(57)35(54)32(51)25(19-48)61-41/h10,23-42,48-58H,9,11-21H2,1-8H3/t23-,24+,25+,26-,27+,28-,29+,30-,31-,32+,33-,34+,35-,36-,37+,38+,39+,40+,41-,42-,44-,45+,46+,47-/m0/s1
InChI key:InChIKey=MYBAONSAUGZRAX-UBQYYSLZSA-N
SMILES:C[C@]12[C@@]([C@]3(C)[C@@](CC1)(C(C)(C)[C@@H](O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)CC3)[H])(C[C@@H](O)[C@]5([C@@]2(C)CC[C@@]5([C@@](O[C@@H]6O[C@H](CO[C@@H]7O[C@@H](CO)[C@H](O)[C@H]7O)[C@@H](O)[C@H](O)[C@H]6O)(CCC=C(C)C)C)[H])[H])[H]
Synonyms:- β-D-Glucopyranoside, (3β,12β)-3-(β-D-glucopyranosyloxy)-12-hydroxydammar-24-en-20-yl 6-O-α-L-arabinofuranosyl-
- Ginsenoside Mb
- Notoginsenoside Fe
- (3β,12β)-3-(β-D-Glucopyranosyloxy)-12-hydroxydammar-24-en-20-yl 6-O-α-L-arabinofuranosyl-β-D-glucopyranoside
- Dammarane, β-D-glucopyranoside deriv.
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Notoginsenoside Fe
CAS:Notoginsenoside Fe can induce gap junction-mediated intercellular communication (GJIC) reductions; and gap junctions have been shown or are believed to be involved in the pathogenesis of many inherited and acquired human diseases, agents that regulate the GJIC function may facilitate prevention and treatment of GJIC-involved diseases.Formula:C47H80O17Purity:95%~99%Molecular weight:917.14Notoginsenoside Fe
CAS:Notoginsenoside Fe (Ginsenoside Mb) is a natural compound found in Panax japlcus var.Formula:C47H80O17Purity:99.43% - 99.93%Color and Shape:SolidMolecular weight:917.13Notoginsenoside Fe
CAS:Notoginsenoside Fe is a bioactive saponin, which is a natural compound sourced from the roots of the Panax notoginseng plant, commonly used in traditional Chinese medicine. This compound is part of the ginsenoside family and is known for its diverse pharmacological properties. As a saponin, Notoginsenoside Fe operates by modulating various biological pathways, including anti-inflammatory and antioxidant effects, which contribute to its therapeutic potential.Formula:C47H80O17Purity:Min. 95%Color and Shape:SolidMolecular weight:917.13 g/mol





