CymitQuimica logo

CAS 88109-06-2

:

(3S)-3-(tritylamino)oxetan-2-one

Description:
(3S)-3-(tritylamino)oxetan-2-one, with the CAS number 88109-06-2, is a chemical compound characterized by its oxetane ring structure, which is a four-membered cyclic ether. The presence of the tritylamino group indicates that it contains a trityl (triphenylmethyl) substituent attached to a nitrogen atom, contributing to its unique properties. This compound is typically used in organic synthesis and may serve as an intermediate in the preparation of more complex molecules. Its stereochemistry, denoted by the (3S) configuration, suggests that it has specific spatial arrangements that can influence its reactivity and interactions with other chemical species. The oxetan-2-one moiety implies that it has a carbonyl group, which can participate in various chemical reactions, such as nucleophilic attacks. Overall, (3S)-3-(tritylamino)oxetan-2-one is notable for its potential applications in medicinal chemistry and materials science, where its structural features can be exploited for the development of novel compounds.
Formula:C22H19NO2
InChI:InChI=1/C22H19NO2/c24-21-20(16-25-21)23-22(17-10-4-1-5-11-17,18-12-6-2-7-13-18)19-14-8-3-9-15-19/h1-15,20,23H,16H2/t20-/m0/s1
SMILES:c1ccc(cc1)C(c1ccccc1)(c1ccccc1)N[C@H]1COC1=O
Synonyms:
  • 2-oxetanone, 3-[(triphenylmethyl)amino]-, (3S)-
  • 88109-06-2
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.