CAS 88113-43-3
:14-methoxy-14-azadispiro[5.1.5.2]pentadec-9-ene-7,15-dione
Description:
14-Methoxy-14-azadispiro[5.1.5.2]pentadec-9-ene-7,15-dione, with the CAS number 88113-43-3, is a complex organic compound characterized by its unique dispiro structure, which consists of multiple interconnected rings. This compound features a methoxy group (-OCH3) and two carbonyl groups (C=O) that contribute to its reactivity and potential biological activity. The presence of the azabicyclic structure indicates that it contains a nitrogen atom within its ring system, which can influence its chemical properties and interactions. The compound's dione functionality suggests it may participate in various chemical reactions, such as nucleophilic additions or condensation reactions. Its structural complexity may also impart interesting pharmacological properties, making it a subject of interest in medicinal chemistry. However, specific information regarding its solubility, stability, and reactivity would require further investigation through experimental studies. Overall, this compound exemplifies the diversity of organic chemistry and the potential for novel applications in various fields, including pharmaceuticals and materials science.
Formula:C15H21NO3
InChI:InChI=1/C15H21NO3/c1-19-16-13(18)14(8-4-2-5-9-14)12(17)15(16)10-6-3-7-11-15/h6,10H,2-5,7-9,11H2,1H3
Synonyms:- 14-azadispiro[5.1.5.2]pentadec-9-ene-7,15-dione, 14-methoxy-
- 14-Methoxy-14-azadispiro[5.1.5.2]pentadec-9-ene-7,15-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
14-Azadispiro[5.1.5.2]pentadec-9-ene-7,15-dione, 14-methoxy-
CAS:Formula:C15H21NO3Molecular weight:263.3321
