CAS 88116-55-6
:N,N'-bis(2,3-dihydroxypropyl)-2,4,6-triiodo-5-[(2-oxopropyl)amino]benzene-1,3-dicarboxamide
Description:
N,N'-bis(2,3-dihydroxypropyl)-2,4,6-triiodo-5-[(2-oxopropyl)amino]benzene-1,3-dicarboxamide, identified by its CAS number 88116-55-6, is a synthetic organic compound characterized by its complex structure, which includes multiple functional groups such as amides, hydroxyls, and iodine substituents. This compound features a benzene ring that is heavily substituted, contributing to its potential applications in various fields, including medicinal chemistry and imaging. The presence of iodine atoms enhances its radiopacity, making it useful in medical imaging as a contrast agent. The dihydroxypropyl groups may impart solubility in biological systems, while the amide linkages suggest potential for hydrogen bonding and interaction with biological macromolecules. Overall, this compound's unique structural features and functional groups position it as a candidate for further research, particularly in the development of diagnostic agents or therapeutic compounds. However, detailed studies on its pharmacokinetics, toxicity, and efficacy would be necessary to fully understand its potential applications.
Formula:C17H22I3N3O7
InChI:InChI=1/C17H22I3N3O7/c1-7(26)2-21-15-13(19)10(16(29)22-3-8(27)5-24)12(18)11(14(15)20)17(30)23-4-9(28)6-25/h8-9,21,24-25,27-28H,2-6H2,1H3,(H,22,29)(H,23,30)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
