CAS 88122-52-5

Notoginsenoside Fc

Description:

Notoginsenoside Fc is a saponin compound primarily derived from the roots of Panax notoginseng, a traditional medicinal plant known for its various health benefits. This compound is characterized by its complex glycosidic structure, which contributes to its biological activity. Notoginsenoside Fc exhibits anti-inflammatory, antioxidant, and neuroprotective properties, making it of interest in pharmacological research. It is often studied for its potential therapeutic effects in conditions such as cardiovascular diseases and neurodegenerative disorders. The substance is typically soluble in organic solvents and has a relatively low solubility in water, which is common for many saponins. Its molecular structure includes multiple sugar moieties attached to a steroid-like backbone, which is responsible for its bioactivity. Additionally, Notoginsenoside Fc is often evaluated for its safety profile and efficacy in various biological assays, contributing to the growing interest in natural products for drug development. Overall, Notoginsenoside Fc represents a significant area of study within the field of natural product chemistry and pharmacology.

Formula: C₅₈H₉₈O₂₆

InChI: InChI=1S/C58H98O26/c1-24(2)10-9-14-58(8,84-51-46(74)41(69)40(68)31(80-51)23-77-49-44(72)36(64)27(62)21-75-49)25-11-16-57(7)35(25)26(61)18-33-55(5)15-13-34(54(3,4)32(55)12-17-56(33,57)6)81-52-47(42(70)38(66)29(19-59)78-52)83-53-48(43(71)39(67)30(20-60)79-53)82-50-45(73)37(65)28(63)22-76-50/h10,25-53,59-74H,9,11-23H2,1-8H3/t25-,26+,27+,28+,29+,30+,31+,32-,33+,34-,35-,36-,37-,38+,39+,40+,41-,42-,43-,44+,45+,46+,47+,48+,49-,50-,51-,52-,53-,55-,56+,57+,58-/m0/s1

InChI key: InChIKey=XBGLCVZQMWKHFC-NMQALWILSA-N

SMILES: C[C@]12[C@@]3(C)[C@@]([C@]4(C)[C@@](CC3)(C(C)(C)[C@@H](O[C@H]5[C@H](O[C@H]6[C@H](O[C@H]7[C@H](O)[C@@H](O)[C@H](O)CO7)[C@@H](O)[C@H](O)[C@@H](CO)O6)[C@@H](O)[C@H](O)[C@@H](CO)O5)CC4)[H])(C[C@@H](O)[C@@]1([C@@]([C@@](O[C@@H]8O[C@H](CO[C@H]9[C@H](O)[C@@H](O)[C@H](O)CO9)[C@@H](O)[C@H](O)[C@H]8O)(CCC=C(C)C)C)(CC2)[H])[H])[H]

Synonyms:

• (3β,12β)-12-Hydroxy-20-[(6-O-β-D-xylopyranosyl-β-D-glucopyranosyl)oxy]dammar-24-en-3-yl O-β-D-xylopyranosyl-(1→2)-O-β-D-glucopyranosyl-(1→2)-β-D-glucopyranoside
• Dammarane, β-D-glucopyranoside deriv.
• β-D-Glucopyranoside, (3β,12β)-12-hydroxy-20-[(6-O-β-D-xylopyranosyl-β-D-glucopyranosyl)oxy]dammar-24-en-3-yl O-β-D-xylopyranosyl-(1→2)-O-β-D-glucopyranosyl-(1→2)-
• Notoginsenoside Fc

NotoginsenosideFc

CAS: 88122-52-5

Formula: C₅₈H₉₈O₂₆

Purity: 98%

Molecular weight: 1211.3831

Ref: IN-DA00H09R

Notoginsenoside Fc

CAS: 88122-52-5

Formula: C₅₈H₉₈O₂₆

Molecular weight: 1211.40

Ref: 7W-GY2591

Notoginsenoside Fc

CAS: 88122-52-5

Notoginsenoside Fc has perfect anti-platelet aggregatory effect.

Formula: C₅₈H₉₈O₂₆

Purity: 95%~99%

Molecular weight: 1211.4

Ref: BP-BP1008

Notoginsenoside Fc

CAS: 88122-52-5

1. Notoginsenoside Fc has perfect anti-platelet aggregatory effect.

Formula: C₅₈H₉₈O₂₆

Purity: 99.22% - 99.94%

Color and Shape: Solid

Molecular weight: 1211.38

Ref: TM-T3S1591

Notoginsenoside Fc

CAS: 88122-52-5

Notoginsenoside Fc is a bioactive compound, which is a saponin derived from the roots of Panax notoginseng. This compound is part of the ginsenoside family, known for its diverse pharmacological activities. The mode of action of Notoginsenoside Fc involves modulation of various cellular pathways, including anti-inflammatory and antioxidative mechanisms. It interacts with signaling proteins and enzymes, influencing cellular responses and homeostasis.

Formula: C₅₈H₉₈O₂₆

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 1,211.38 g/mol

Ref: 3D-FN74238