CAS 88122-52-5
:Notoginsenoside Fc
Description:
Notoginsenoside Fc is a saponin compound primarily derived from the roots of Panax notoginseng, a traditional medicinal plant known for its various health benefits. This compound is characterized by its complex glycosidic structure, which contributes to its biological activity. Notoginsenoside Fc exhibits anti-inflammatory, antioxidant, and neuroprotective properties, making it of interest in pharmacological research. It is often studied for its potential therapeutic effects in conditions such as cardiovascular diseases and neurodegenerative disorders. The substance is typically soluble in organic solvents and has a relatively low solubility in water, which is common for many saponins. Its molecular structure includes multiple sugar moieties attached to a steroid-like backbone, which is responsible for its bioactivity. Additionally, Notoginsenoside Fc is often evaluated for its safety profile and efficacy in various biological assays, contributing to the growing interest in natural products for drug development. Overall, Notoginsenoside Fc represents a significant area of study within the field of natural product chemistry and pharmacology.
Formula:C58H98O26
InChI:InChI=1S/C58H98O26/c1-24(2)10-9-14-58(8,84-51-46(74)41(69)40(68)31(80-51)23-77-49-44(72)36(64)27(62)21-75-49)25-11-16-57(7)35(25)26(61)18-33-55(5)15-13-34(54(3,4)32(55)12-17-56(33,57)6)81-52-47(42(70)38(66)29(19-59)78-52)83-53-48(43(71)39(67)30(20-60)79-53)82-50-45(73)37(65)28(63)22-76-50/h10,25-53,59-74H,9,11-23H2,1-8H3/t25-,26+,27+,28+,29+,30+,31+,32-,33+,34-,35-,36-,37-,38+,39+,40+,41-,42-,43-,44+,45+,46+,47+,48+,49-,50-,51-,52-,53-,55-,56+,57+,58-/m0/s1
InChI key:InChIKey=XBGLCVZQMWKHFC-NMQALWILSA-N
SMILES:C[C@]12[C@@]3(C)[C@@]([C@]4(C)[C@@](CC3)(C(C)(C)[C@@H](O[C@H]5[C@H](O[C@H]6[C@H](O[C@H]7[C@H](O)[C@@H](O)[C@H](O)CO7)[C@@H](O)[C@H](O)[C@@H](CO)O6)[C@@H](O)[C@H](O)[C@@H](CO)O5)CC4)[H])(C[C@@H](O)[C@@]1([C@@]([C@@](O[C@@H]8O[C@H](CO[C@H]9[C@H](O)[C@@H](O)[C@H](O)CO9)[C@@H](O)[C@H](O)[C@H]8O)(CCC=C(C)C)C)(CC2)[H])[H])[H]
Synonyms:- (3β,12β)-12-Hydroxy-20-[(6-O-β-D-xylopyranosyl-β-D-glucopyranosyl)oxy]dammar-24-en-3-yl O-β-D-xylopyranosyl-(1→2)-O-β-D-glucopyranosyl-(1→2)-β-D-glucopyranoside
- Dammarane, β-D-glucopyranoside deriv.
- β-D-Glucopyranoside, (3β,12β)-12-hydroxy-20-[(6-O-β-D-xylopyranosyl-β-D-glucopyranosyl)oxy]dammar-24-en-3-yl O-β-D-xylopyranosyl-(1→2)-O-β-D-glucopyranosyl-(1→2)-
- Notoginsenoside Fc
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Notoginsenoside Fc
CAS:Notoginsenoside Fc has perfect anti-platelet aggregatory effect.Formula:C58H98O26Purity:95%~99%Molecular weight:1211.4Notoginsenoside Fc
CAS:1. Notoginsenoside Fc has perfect anti-platelet aggregatory effect.
Formula:C58H98O26Purity:99.22% - 99.94%Color and Shape:SolidMolecular weight:1211.38Notoginsenoside Fc
CAS:Notoginsenoside Fc is a bioactive compound, which is a saponin derived from the roots of Panax notoginseng. This compound is part of the ginsenoside family, known for its diverse pharmacological activities. The mode of action of Notoginsenoside Fc involves modulation of various cellular pathways, including anti-inflammatory and antioxidative mechanisms. It interacts with signaling proteins and enzymes, influencing cellular responses and homeostasis.Formula:C58H98O26Purity:Min. 95%Color and Shape:PowderMolecular weight:1,211.38 g/mol




