
CAS 88124-26-9
:N-(6,11-Dihydro-5-methyl-6,11-dioxo-5H-dibenz[b,e]azepin-10-yl)acetamide
Description:
N-(6,11-Dihydro-5-methyl-6,11-dioxo-5H-dibenz[b,e]azepin-10-yl)acetamide, with the CAS number 88124-26-9, is a chemical compound characterized by its complex structure, which includes a dibenzazepine core. This compound features a fused bicyclic system that contributes to its unique chemical properties. The presence of the acetamide functional group suggests potential for hydrogen bonding, influencing its solubility and reactivity. The dioxo groups indicate that it may exhibit significant electron-withdrawing characteristics, which can affect its interaction with biological targets. Additionally, the methyl group on the dibenzazepine structure may influence its steric and electronic properties, potentially impacting its pharmacological activity. Compounds of this nature are often studied for their potential therapeutic applications, particularly in the fields of psychiatry and neurology, due to their structural similarity to known psychoactive agents. Overall, this compound's unique structural features and functional groups make it a subject of interest in medicinal chemistry and drug development.
Formula:C17H14N2O3
InChI:InChI=1S/C17H14N2O3/c1-10(20)18-13-8-5-7-12-15(13)16(21)11-6-3-4-9-14(11)19(2)17(12)22/h3-9H,1-2H3,(H,18,20)
InChI key:InChIKey=KLSKLNWJEDXFSD-UHFFFAOYSA-N
SMILES:N(C(C)=O)C1=C2C(C(=O)N(C)C=3C(C2=O)=CC=CC3)=CC=C1
Synonyms:- Adosupine
- 5H-Dibenz[b,e]azepine, acetamide deriv.
- Adosopine
- Acetamide, N-(6,11-dihydro-5-methyl-6,11-dioxo-5H-dibenz[b,e]azepin-10-yl)-
- N-(6,11-Dihydro-5-methyl-6,11-dioxo-5H-dibenz[b,e]azepin-10-yl)acetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Adosopine
CAS:<p>Adosopine is a dibenzoazepine which affects urinary bladder hyperreflexia and may be suitable for treating urinary incontinence.</p>Formula:C17H14N2O3Color and Shape:SolidMolecular weight:294.3
